C27H33ClO2 — CID 129225796
4-[5-chloro-2-(3-cyclopentylcyclopentyl)-1-(4-hydroxyphenyl)pent-1-enyl]phenol (PubChem CID 129225796) has the molecular formula C27H33ClO2 and a molecular weight of 425.01 g/mol. Its IUPAC name is 4-[5-chloro-2-(3-cyclopentylcyclopentyl)-1-(4-hydroxyphenyl)pent-1-enyl]phenol.
| Compound Name | 4-[5-chloro-2-(3-cyclopentylcyclopentyl)-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 129225796 |
| Molecular Formula | C27H33ClO2 |
| Molecular Weight | 425.01 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[5-chloro-2-(3-cyclopentylcyclopentyl)-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
| SMILES | Oc1ccc(C(=C(CCCCl)C2CCC(C3CCCC3)C2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H33ClO2/c28-17-3-6-26(23-8-7-22(18-23)19-4-1-2-5-19)27(20-9-13-24(29)14-10-20)21-11-15-25(30)16-12-21/h9-16,19,22-23,29-30H,1-8,17-18H2 |
| InChIKey | TZWZUJBKKIMWOM-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.01 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|