C27H36FeO2 — CID 162289921
cyclopentane;4-[2-cyclopentyl-1-(4-hydroxyphenyl)pent-1-enyl]phenol;iron (PubChem CID 162289921) has the molecular formula C27H36FeO2 and a molecular weight of 448.43 g/mol. Its IUPAC name is cyclopentane;4-[2-cyclopentyl-1-(4-hydroxyphenyl)pent-1-enyl]phenol;iron.
| Compound Name | cyclopentane;4-[2-cyclopentyl-1-(4-hydroxyphenyl)pent-1-enyl]phenol;iron |
|---|---|
| PubChem CID | 162289921 |
| Molecular Formula | C27H36FeO2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | cyclopentane;4-[2-cyclopentyl-1-(4-hydroxyphenyl)pent-1-enyl]phenol;iron |
| SMILES | C1CCCC1.CCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)C1CCCC1.[Fe] |
| InChI | InChI=1S/C22H26O2.C5H10.Fe/c1-2-5-21(16-6-3-4-7-16)22(17-8-12-19(23)13-9-17)18-10-14-20(24)15-11-18;1-2-4-5-3-1;/h8-16,23-24H,2-7H2,1H3;1-5H2; |
| InChIKey | WYYZEOHWQPPYIU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|