C35H41FeNO4 — CID 162301242
cyclopentane;2-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-hydroxy-3H-isoindol-1-one;iron (PubChem CID 162301242) has the molecular formula C35H41FeNO4 and a molecular weight of 595.56 g/mol. Its IUPAC name is cyclopentane;2-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-hydroxy-3H-isoindol-1-one;iron.
| Compound Name | cyclopentane;2-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-hydroxy-3H-isoindol-1-one;iron |
|---|---|
| PubChem CID | 162301242 |
| Molecular Formula | C35H41FeNO4 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | cyclopentane;2-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-hydroxy-3H-isoindol-1-one;iron |
| SMILES | C1CCCC1.O=C1c2ccccc2C(O)N1CCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)C1CCCC1.[Fe] |
| InChI | InChI=1S/C30H31NO4.C5H10.Fe/c32-23-15-11-21(12-16-23)28(22-13-17-24(33)18-14-22)25(20-6-1-2-7-20)10-5-19-31-29(34)26-8-3-4-9-27(26)30(31)35;1-2-4-5-3-1;/h3-4,8-9,11-18,20,29,32-34H,1-2,5-7,10,19H2;1-5H2; |
| InChIKey | VRGNXHJIOTZVBS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|