C24H26O2 — CID 118056050
4-[2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)hept-1-enyl]phenol (PubChem CID 118056050) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-[2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)hept-1-enyl]phenol.
| Compound Name | 4-[2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)hept-1-enyl]phenol |
|---|---|
| PubChem CID | 118056050 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)hept-1-enyl]phenol |
| SMILES | CCCCCC(C1=CC=CC1)=C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H26O2/c1-2-3-4-9-23(18-7-5-6-8-18)24(19-10-14-21(25)15-11-19)20-12-16-22(26)17-13-20/h5-7,10-17,25-26H,2-4,8-9H2,1H3 |
| InChIKey | JIFRZNITLVSLPB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|