C28H30O3 — CID 143470826
4-[1-(4-hydroxyphenyl)-2-(4-prop-1-ynylphenyl)hex-1-enyl]phenol;methanol (PubChem CID 143470826) has the molecular formula C28H30O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-2-(4-prop-1-ynylphenyl)hex-1-enyl]phenol;methanol.
| Compound Name | 4-[1-(4-hydroxyphenyl)-2-(4-prop-1-ynylphenyl)hex-1-enyl]phenol;methanol |
|---|---|
| PubChem CID | 143470826 |
| Molecular Formula | C28H30O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-2-(4-prop-1-ynylphenyl)hex-1-enyl]phenol;methanol |
| SMILES | CC#Cc1ccc(C(CCCC)=C(c2ccc(O)cc2)c2ccc(O)cc2)cc1.CO |
| InChI | InChI=1S/C27H26O2.CH4O/c1-3-5-7-26(21-10-8-20(6-4-2)9-11-21)27(22-12-16-24(28)17-13-22)23-14-18-25(29)19-15-23;1-2/h8-19,28-29H,3,5,7H2,1-2H3;2H,1H3 |
| InChIKey | USKLXCJNWTXENY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|