C27H28O4 — CID 69293174
3-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]phenyl]propanoic acid (PubChem CID 69293174) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69293174 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]phenyl]propanoic acid |
| SMILES | CCCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C27H28O4/c1-2-3-4-25(20-8-5-19(6-9-20)7-18-26(30)31)27(21-10-14-23(28)15-11-21)22-12-16-24(29)17-13-22/h5-6,8-17,28-29H,2-4,7,18H2,1H3,(H,30,31) |
| InChIKey | FUJGADUSSUFCDR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|