C21H34O3 — CID 174942592
1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid (PubChem CID 174942592) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 174942592 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CCCC1CCCCC1CCC.O=C(O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C12H24.C9H10O3/c1-3-7-11-9-5-6-10-12(11)8-4-2;10-8-4-1-7(2-5-8)3-6-9(11)12/h11-12H,3-10H2,1-2H3;1-2,4-5,10H,3,6H2,(H,11,12) |
| InChIKey | UTYYKOOCUOUUIV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |