1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid

C21H34O3 — CID 174942592

IUPAC1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid
SMILESCCCC1CCCCC1CCC.O=C(O)CCc1ccc(O)cc1
InChIInChI=1S/C12H24.C9H10O3/c1-3-7-11-9-5-6-10-12(11)8-4-2;10-8-4-1-7(2-5-8)3-6-9(11)12/h11-12H,3-10H2,1-2H3;1-2,4-5,10H,3,6H2,(H,11,12)
InChIKeyUTYYKOOCUOUUIV-UHFFFAOYSA-N
MW334.50 g/mol
LogP5.80
Rot. Bonds7

About 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid

1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid (PubChem CID 174942592) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid.

Molecular Properties

Compound Name1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid
PubChem CID174942592
Molecular FormulaC21H34O3
Molecular Weight334.50 g/mol
Exact Mass334.25
IUPAC Name1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid
SMILESCCCC1CCCCC1CCC.O=C(O)CCc1ccc(O)cc1
InChIInChI=1S/C12H24.C9H10O3/c1-3-7-11-9-5-6-10-12(11)8-4-2;10-8-4-1-7(2-5-8)3-6-9(11)12/h11-12H,3-10H2,1-2H3;1-2,4-5,10H,3,6H2,(H,11,12)
InChIKeyUTYYKOOCUOUUIV-UHFFFAOYSA-N
XLogP5.80
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500334.50
LogP ≤ 55.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid?
The IUPAC name of 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid (CID 174942592) is 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid.
What is the SMILES notation for 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid?
The canonical SMILES for 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid is CCCC1CCCCC1CCC.O=C(O)CCc1ccc(O)cc1.
What is the InChIKey of 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid?
The InChIKey is UTYYKOOCUOUUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24.C9H10O3/c1-3-7-11-9-5-6-10-12(11)8-4-2;10-8-4-1-7(2-5-8)3-6-9(11)12/h11-12H,3-10H2,1-2H3;1-2,4-5,10H,3,6H2,(H,11,12).
What are the key properties of 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid?
1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid has a molecular weight of 334.50 g/mol, XLogP of 5.80, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dipropylcyclohexane;3-(4-hydroxyphenyl)propanoic acid is sourced from PubChem (CID 174942592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).