About CID 175200030
CID 175200030 (PubChem CID 175200030) has the molecular formula C41H65N8O3Zn-
and a molecular weight of 783.41 g/mol.
Molecular Properties
| Compound Name | CID 175200030 |
| PubChem CID | 175200030 |
| Molecular Formula | C41H65N8O3Zn- |
| Molecular Weight | 783.41 g/mol |
| Exact Mass | 781.45 |
| IUPAC Name | — |
| SMILES | O=C(O)CCc1ccc(O)cc1.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Zn] |
| InChI | InChI=1S/C32H55N8.C9H10O3.Zn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;10-8-4-1-7(2-5-8)3-6-9(11)12;/h9,17-40H,1-8,10-16H2;1-2,4-5,10H,3,6H2,(H,11,12);/q-1;; |
| InChIKey | FWNAFEOVIWKLNP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 783.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175200030 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175200030?
The IUPAC name of CID 175200030 (CID 175200030) is not available.
What is the SMILES notation for CID 175200030?
The canonical SMILES for CID 175200030 is O=C(O)CCc1ccc(O)cc1.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Zn].
What is the InChIKey of CID 175200030?
The InChIKey is FWNAFEOVIWKLNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H55N8.C9H10O3.Zn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;10-8-4-1-7(2-5-8)3-6-9(11)12;/h9,17-40H,1-8,10-16H2;1-2,4-5,10H,3,6H2,(H,11,12);/q-1;;.
What are the key properties of CID 175200030?
CID 175200030 has a molecular weight of 783.41 g/mol, XLogP of 3.83, 3 rotatable bonds, 10 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175200030 is sourced from PubChem (CID 175200030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).