C41H65N8O3Zn- — CID 175200030
CID 175200030 (PubChem CID 175200030) has the molecular formula C41H65N8O3Zn- and a molecular weight of 783.41 g/mol.
| Compound Name | CID 175200030 |
|---|---|
| PubChem CID | 175200030 |
| Molecular Formula | C41H65N8O3Zn- |
| Molecular Weight | 783.41 g/mol |
| Exact Mass | 781.45 |
| IUPAC Name | — |
| SMILES | O=C(O)CCc1ccc(O)cc1.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Zn] |
| InChI | InChI=1S/C32H55N8.C9H10O3.Zn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;10-8-4-1-7(2-5-8)3-6-9(11)12;/h9,17-40H,1-8,10-16H2;1-2,4-5,10H,3,6H2,(H,11,12);/q-1;; |
| InChIKey | FWNAFEOVIWKLNP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|