About CID 175391429
CID 175391429 (PubChem CID 175391429) has the molecular formula C36H64N8Zn
and a molecular weight of 674.35 g/mol.
Molecular Properties
| Compound Name | CID 175391429 |
| PubChem CID | 175391429 |
| Molecular Formula | C36H64N8Zn |
| Molecular Weight | 674.35 g/mol |
| Exact Mass | 672.45 |
| IUPAC Name | — |
| SMILES | C[C-](C)C.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Zn+2] |
| InChI | InChI=1S/C32H55N8.C4H9.Zn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-4(2)3;/h9,17-40H,1-8,10-16H2;1-3H3;/q2*-1;+2 |
| InChIKey | GLLWCVIREHIZIW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 674.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175391429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175391429?
The IUPAC name of CID 175391429 (CID 175391429) is not available.
What is the SMILES notation for CID 175391429?
The canonical SMILES for CID 175391429 is C[C-](C)C.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Zn+2].
What is the InChIKey of CID 175391429?
The InChIKey is GLLWCVIREHIZIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H55N8.C4H9.Zn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-4(2)3;/h9,17-40H,1-8,10-16H2;1-3H3;/q2*-1;+2.
What are the key properties of CID 175391429?
CID 175391429 has a molecular weight of 674.35 g/mol, XLogP of 4.04, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175391429 is sourced from PubChem (CID 175391429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).