About CID 173239497
CID 173239497 (PubChem CID 173239497) has the molecular formula C36H65N8O2Ti-
and a molecular weight of 689.84 g/mol.
Molecular Properties
| Compound Name | CID 173239497 |
| PubChem CID | 173239497 |
| Molecular Formula | C36H65N8O2Ti- |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 689.47 |
| IUPAC Name | — |
| SMILES | CC(O)C(C)O.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Ti] |
| InChI | InChI=1S/C32H55N8.C4H10O2.Ti/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-3(5)4(2)6;/h9,17-40H,1-8,10-16H2;3-6H,1-2H3;/q-1;; |
| InChIKey | HVOUPDZFNFXFDO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 173239497 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173239497?
The IUPAC name of CID 173239497 (CID 173239497) is not available.
What is the SMILES notation for CID 173239497?
The canonical SMILES for CID 173239497 is CC(O)C(C)O.[CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[Ti].
What is the InChIKey of CID 173239497?
The InChIKey is HVOUPDZFNFXFDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H55N8.C4H10O2.Ti/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-3(5)4(2)6;/h9,17-40H,1-8,10-16H2;3-6H,1-2H3;/q-1;;.
What are the key properties of CID 173239497?
CID 173239497 has a molecular weight of 689.84 g/mol, XLogP of 2.17, 1 rotatable bonds, 10 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173239497 is sourced from PubChem (CID 173239497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).