About CID 174455858
CID 174455858 (PubChem CID 174455858) has the molecular formula C36H64LuN8-2
and a molecular weight of 783.93 g/mol.
Molecular Properties
| Compound Name | CID 174455858 |
| PubChem CID | 174455858 |
| Molecular Formula | C36H64LuN8-2 |
| Molecular Weight | 783.93 g/mol |
| Exact Mass | 783.47 |
| IUPAC Name | — |
| SMILES | [CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[CH2-]C(C)C.[Lu] |
| InChI | InChI=1S/C32H55N8.C4H9.Lu/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-4(2)3;/h9,17-40H,1-8,10-16H2;4H,1H2,2-3H3;/q2*-1; |
| InChIKey | BZIIEXOQNYBZQB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 783.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 174455858 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174455858?
The IUPAC name of CID 174455858 (CID 174455858) is not available.
What is the SMILES notation for CID 174455858?
The canonical SMILES for CID 174455858 is [CH-]1CCCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C12.[CH2-]C(C)C.[Lu].
What is the InChIKey of CID 174455858?
The InChIKey is BZIIEXOQNYBZQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H55N8.C4H9.Lu/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-4(2)3;/h9,17-40H,1-8,10-16H2;4H,1H2,2-3H3;/q2*-1;.
What are the key properties of CID 174455858?
CID 174455858 has a molecular weight of 783.93 g/mol, XLogP of 3.90, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174455858 is sourced from PubChem (CID 174455858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).