C24H18F3N5O — CID 118056273
N-[4-(2-methyl-4-pyridinyl)phenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 118056273) has the molecular formula C24H18F3N5O and a molecular weight of 449.44 g/mol. Its IUPAC name is N-[4-(2-methyl-4-pyridinyl)phenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | N-[4-(2-methyl-4-pyridinyl)phenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 118056273 |
| Molecular Formula | C24H18F3N5O |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[4-(2-methyl-4-pyridinyl)phenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | Cc1cc(-c2ccc(Nc3ncc4c(n3)N(c3cc(F)c(F)c(F)c3)CCO4)cc2)ccn1 |
| InChI | InChI=1S/C24H18F3N5O/c1-14-10-16(6-7-28-14)15-2-4-17(5-3-15)30-24-29-13-21-23(31-24)32(8-9-33-21)18-11-19(25)22(27)20(26)12-18/h2-7,10-13H,8-9H2,1H3,(H,29,30,31) |
| InChIKey | XYJPAYCURTVXKS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|