C21H42O4S — CID 118057476
2-[(Z)-octadec-9-enoxy]ethyl methanesulfonate (PubChem CID 118057476) has the molecular formula C21H42O4S and a molecular weight of 390.63 g/mol. Its IUPAC name is 2-[(Z)-octadec-9-enoxy]ethyl methanesulfonate.
| Compound Name | 2-[(Z)-octadec-9-enoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 118057476 |
| Molecular Formula | C21H42O4S |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-[(Z)-octadec-9-enoxy]ethyl methanesulfonate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCCOS(C)(=O)=O |
| InChI | InChI=1S/C21H42O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-20-21-25-26(2,22)23/h10-11H,3-9,12-21H2,1-2H3/b11-10- |
| InChIKey | JWQPDDBWFXXVHC-KHPPLWFESA-N |
| XLogP | 6.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|