About [(Z)-icos-11-enyl] methanesulfonate
[(Z)-icos-11-enyl] methanesulfonate (PubChem CID 86699632) has the molecular formula C21H42O3S
and a molecular weight of 374.63 g/mol. Its IUPAC name is [(Z)-icos-11-enyl] methanesulfonate.
Molecular Properties
| Compound Name | [(Z)-icos-11-enyl] methanesulfonate |
| PubChem CID | 86699632 |
| Molecular Formula | C21H42O3S |
| Molecular Weight | 374.63 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | [(Z)-icos-11-enyl] methanesulfonate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCOS(C)(=O)=O |
| InChI | InChI=1S/C21H42O3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-25(2,22)23/h10-11H,3-9,12-21H2,1-2H3/b11-10- |
| InChIKey | XEGHZUQKODVIBC-KHPPLWFESA-N |
| XLogP | 6.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-icos-11-enyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-icos-11-enyl] methanesulfonate?
The IUPAC name of [(Z)-icos-11-enyl] methanesulfonate (CID 86699632) is [(Z)-icos-11-enyl] methanesulfonate.
What is the SMILES notation for [(Z)-icos-11-enyl] methanesulfonate?
The canonical SMILES for [(Z)-icos-11-enyl] methanesulfonate is CCCCCCCC/C=C\CCCCCCCCCCOS(C)(=O)=O.
What is the InChIKey of [(Z)-icos-11-enyl] methanesulfonate?
The InChIKey is XEGHZUQKODVIBC-KHPPLWFESA-N. The full InChI is InChI=1S/C21H42O3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-25(2,22)23/h10-11H,3-9,12-21H2,1-2H3/b11-10-.
What are the key properties of [(Z)-icos-11-enyl] methanesulfonate?
[(Z)-icos-11-enyl] methanesulfonate has a molecular weight of 374.63 g/mol, XLogP of 6.78, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-icos-11-enyl] methanesulfonate is sourced from PubChem (CID 86699632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).