About [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate
[(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate (PubChem CID 87353753) has the molecular formula C24H49NO5S
and a molecular weight of 463.73 g/mol. Its IUPAC name is [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate |
| PubChem CID | 87353753 |
| Molecular Formula | C24H49NO5S |
| Molecular Weight | 463.73 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOS(C)(=O)=O.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C19H38O3S.C5H11NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-23(2,20)21;1-6(2,3)4-5(7)8/h10-11H,3-9,12-19H2,1-2H3;4H2,1-3H3/b11-10+; |
| InChIKey | TYDOLGMEZVNJCS-ASTDGNLGSA-N |
| XLogP | 4.44 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate?
The IUPAC name of [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate (CID 87353753) is [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate?
The canonical SMILES for [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate is CCCCCCCC/C=C/CCCCCCCCOS(C)(=O)=O.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate?
The InChIKey is TYDOLGMEZVNJCS-ASTDGNLGSA-N. The full InChI is InChI=1S/C19H38O3S.C5H11NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-23(2,20)21;1-6(2,3)4-5(7)8/h10-11H,3-9,12-19H2,1-2H3;4H2,1-3H3/b11-10+;.
What are the key properties of [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate?
[(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate has a molecular weight of 463.73 g/mol, XLogP of 4.44, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-octadec-9-enyl] methanesulfonate;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 87353753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).