C22H20FN3O4S — CID 118060266
tert-butyl 4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazole-1-carboxylate (PubChem CID 118060266) has the molecular formula C22H20FN3O4S and a molecular weight of 441.48 g/mol. Its IUPAC name is tert-butyl 4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 118060266 |
| Molecular Formula | C22H20FN3O4S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | tert-butyl 4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cn(S(=O)(=O)c3ccccc3)c3cc(F)ccc23)cn1 |
| InChI | InChI=1S/C22H20FN3O4S/c1-22(2,3)30-21(27)25-13-15(12-24-25)19-14-26(20-11-16(23)9-10-18(19)20)31(28,29)17-7-5-4-6-8-17/h4-14H,1-3H3 |
| InChIKey | PHRZXDWAWWIDLP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |