C15H17FN4O2S — CID 56793257
1-ethyl-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]pyrazole-4-sulfonamide (PubChem CID 56793257) has the molecular formula C15H17FN4O2S and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-ethyl-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 56793257 |
| Molecular Formula | C15H17FN4O2S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-ethyl-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCc2c[nH]c3ccc(F)cc23)cn1 |
| InChI | InChI=1S/C15H17FN4O2S/c1-2-20-10-13(9-18-20)23(21,22)19-6-5-11-8-17-15-4-3-12(16)7-14(11)15/h3-4,7-10,17,19H,2,5-6H2,1H3 |
| InChIKey | MNQYFROXECKTBH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |