C17H15F3N2O2S — CID 3776949
2,3,4-trifluoro-N-[2-(5-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 3776949) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(5-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(5-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3776949 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(5-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc2[nH]cc(CCNS(=O)(=O)c3ccc(F)c(F)c3F)c2c1 |
| InChI | InChI=1S/C17H15F3N2O2S/c1-10-2-4-14-12(8-10)11(9-21-14)6-7-22-25(23,24)15-5-3-13(18)16(19)17(15)20/h2-5,8-9,21-22H,6-7H2,1H3 |
| InChIKey | FJVJGTIPSOQBSG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|