C10H10N2O5S — CID 118061580
(1,1-dioxo-1,3-thiazolidin-3-yl)-(3-nitrophenyl)methanone (PubChem CID 118061580) has the molecular formula C10H10N2O5S and a molecular weight of 270.27 g/mol. Its IUPAC name is (1,1-dioxo-1,3-thiazolidin-3-yl)-(3-nitrophenyl)methanone.
| Compound Name | (1,1-dioxo-1,3-thiazolidin-3-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 118061580 |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (1,1-dioxo-1,3-thiazolidin-3-yl)-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H10N2O5S/c13-10(11-4-5-18(16,17)7-11)8-2-1-3-9(6-8)12(14)15/h1-3,6H,4-5,7H2 |
| InChIKey | QEDSVXCNTVYJQR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|