C13H19NO2 — CID 11806251
(1R,5S)-8-methyl-2-[(E)-2-methylbut-2-enoyl]-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 11806251) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (1R,5S)-8-methyl-2-[(E)-2-methylbut-2-enoyl]-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,5S)-8-methyl-2-[(E)-2-methylbut-2-enoyl]-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 11806251 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1R,5S)-8-methyl-2-[(E)-2-methylbut-2-enoyl]-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | C/C=C(\C)C(=O)C1C(=O)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C13H19NO2/c1-4-8(2)13(16)12-10-6-5-9(14(10)3)7-11(12)15/h4,9-10,12H,5-7H2,1-3H3/b8-4+/t9-,10+,12?/m0/s1 |
| InChIKey | YHCPBKKJCMCUDP-OSUFLNAVSA-N |
| XLogP | 1.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|