C16H23NO2 — CID 163105591
(5S,6R)-6-[(8R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carbonyl]-5-methylcyclohex-2-en-1-one (PubChem CID 163105591) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (5S,6R)-6-[(8R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carbonyl]-5-methylcyclohex-2-en-1-one.
| Compound Name | (5S,6R)-6-[(8R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carbonyl]-5-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163105591 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (5S,6R)-6-[(8R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carbonyl]-5-methylcyclohex-2-en-1-one |
| SMILES | C[C@H]1CC=CC(=O)[C@@H]1C(=O)[C@@H]1CCCN2CCC[C@@H]12 |
| InChI | InChI=1S/C16H23NO2/c1-11-5-2-8-14(18)15(11)16(19)12-6-3-9-17-10-4-7-13(12)17/h2,8,11-13,15H,3-7,9-10H2,1H3/t11-,12+,13-,15+/m0/s1 |
| InChIKey | PVKYIBHVAJSUIB-SFDCQRBFSA-N |
| XLogP | 2.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|