C53H28Br4O — CID 118065875
3,6,14,16-tetrakis(3-bromophenyl)-4-phenylhexacyclo[10.9.2.02,7.08,23.013,17.018,22]tricosa-1(22),2,4,6,8(23),9,11,13,16,18,20-undecaen-15-one (PubChem CID 118065875) has the molecular formula C53H28Br4O and a molecular weight of 1000.42 g/mol. Its IUPAC name is 3,6,14,16-tetrakis(3-bromophenyl)-4-phenylhexacyclo[10.9.2.02,7.08,23.013,17.018,22]tricosa-1(22),2,4,6,8(23),9,11,13,16,18,20-undecaen-15-one.
| Compound Name | 3,6,14,16-tetrakis(3-bromophenyl)-4-phenylhexacyclo[10.9.2.02,7.08,23.013,17.018,22]tricosa-1(22),2,4,6,8(23),9,11,13,16,18,20-undecaen-15-one |
|---|---|
| PubChem CID | 118065875 |
| Molecular Formula | C53H28Br4O |
| Molecular Weight | 1000.42 g/mol |
| Exact Mass | 995.89 |
| IUPAC Name | 3,6,14,16-tetrakis(3-bromophenyl)-4-phenylhexacyclo[10.9.2.02,7.08,23.013,17.018,22]tricosa-1(22),2,4,6,8(23),9,11,13,16,18,20-undecaen-15-one |
| SMILES | O=c1c(-c2cccc(Br)c2)c2c3cccc4c5c(-c6cccc(Br)c6)cc(-c6ccccc6)c(-c6cccc(Br)c6)c5c5cccc(c2c1-c1cccc(Br)c1)c5c43 |
| InChI | InChI=1S/C53H28Br4O/c54-34-16-4-12-30(24-34)43-28-42(29-10-2-1-3-11-29)44(31-13-5-17-35(55)25-31)50-39-21-9-23-41-48(39)47-38(49(43)50)20-8-22-40(47)51-45(32-14-6-18-36(56)26-32)53(58)46(52(41)51)33-15-7-19-37(57)27-33/h1-28H |
| InChIKey | ORAORUBUXMGSOH-UHFFFAOYSA-N |
| XLogP | 17.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.42 |
| LogP ≤ 5 | 17.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|