C33H52O2 — CID 118065939
(1R,3aS,5aR,5bR,7aR,8S,11aR)-8-ethyl-3a-(1-methoxyethenyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one (PubChem CID 118065939) has the molecular formula C33H52O2 and a molecular weight of 480.78 g/mol. Its IUPAC name is (1R,3aS,5aR,5bR,7aR,8S,11aR)-8-ethyl-3a-(1-methoxyethenyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one.
| Compound Name | (1R,3aS,5aR,5bR,7aR,8S,11aR)-8-ethyl-3a-(1-methoxyethenyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one |
|---|---|
| PubChem CID | 118065939 |
| Molecular Formula | C33H52O2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,11aR)-8-ethyl-3a-(1-methoxyethenyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-one |
| SMILES | C=C(C)C1CC[C@]2(C(=C)OC)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(=O)[C@@](C)(CC)[C@@H]5CC[C@]43C)C12 |
| InChI | InChI=1S/C33H52O2/c1-10-29(5)25-14-17-32(8)26(30(25,6)16-15-27(29)34)12-11-24-28-23(21(2)3)13-18-33(28,22(4)35-9)20-19-31(24,32)7/h23-26,28H,2,4,10-20H2,1,3,5-9H3/t23?,24?,25-,26?,28?,29-,30-,31+,32+,33+/m0/s1 |
| InChIKey | HBPYPXOPBJFIES-ITHRBYSJSA-N |
| XLogP | 8.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|