C36H55NO6 — CID 143591222
dimethyl 2-[[(1R,5aR,5bR,11aR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]butanedioate (PubChem CID 143591222) has the molecular formula C36H55NO6 and a molecular weight of 597.84 g/mol. Its IUPAC name is dimethyl 2-[[(1R,5aR,5bR,11aR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[(1R,5aR,5bR,11aR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 143591222 |
| Molecular Formula | C36H55NO6 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.40 |
| IUPAC Name | dimethyl 2-[[(1R,5aR,5bR,11aR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]butanedioate |
| SMILES | C=C(C)C1CCC2(C(=O)NC(CC(=O)OC)C(=O)OC)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(=O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C36H55NO6/c1-21(2)22-12-17-36(31(41)37-24(30(40)43-9)20-28(39)42-8)19-18-34(6)23(29(22)36)10-11-26-33(5)15-14-27(38)32(3,4)25(33)13-16-35(26,34)7/h22-26,29H,1,10-20H2,2-9H3,(H,37,41)/t22?,23?,24?,25?,26?,29?,33-,34+,35+,36?/m0/s1 |
| InChIKey | CNKAIOOJMTUXNC-UBCOQKDPSA-N |
| XLogP | 6.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|