About 7-fluoro-4-iodoquinoline
7-fluoro-4-iodoquinoline (PubChem CID 118066569) has the molecular formula C9H5FIN
and a molecular weight of 273.05 g/mol. Its IUPAC name is 7-fluoro-4-iodoquinoline.
Molecular Properties
| Compound Name | 7-fluoro-4-iodoquinoline |
| PubChem CID | 118066569 |
| Molecular Formula | C9H5FIN |
| Molecular Weight | 273.05 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 7-fluoro-4-iodoquinoline |
| SMILES | Fc1ccc2c(I)ccnc2c1 |
| InChI | InChI=1S/C9H5FIN/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H |
| InChIKey | GNOWOPZTFSURHQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-4-iodoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-iodoquinoline?
The IUPAC name of 7-fluoro-4-iodoquinoline (CID 118066569) is 7-fluoro-4-iodoquinoline.
What is the SMILES notation for 7-fluoro-4-iodoquinoline?
The canonical SMILES for 7-fluoro-4-iodoquinoline is Fc1ccc2c(I)ccnc2c1.
What is the InChIKey of 7-fluoro-4-iodoquinoline?
The InChIKey is GNOWOPZTFSURHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FIN/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H.
What are the key properties of 7-fluoro-4-iodoquinoline?
7-fluoro-4-iodoquinoline has a molecular weight of 273.05 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-iodoquinoline is sourced from PubChem (CID 118066569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).