C17H30N2O3 — CID 118067413
(tert-butylamino) (3aR,4R,6S,6aS)-4-methyl-3-pentan-3-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-6-carboxylate (PubChem CID 118067413) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is (tert-butylamino) (3aR,4R,6S,6aS)-4-methyl-3-pentan-3-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-6-carboxylate.
| Compound Name | (tert-butylamino) (3aR,4R,6S,6aS)-4-methyl-3-pentan-3-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 118067413 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (tert-butylamino) (3aR,4R,6S,6aS)-4-methyl-3-pentan-3-yl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-6-carboxylate |
| SMILES | CCC(CC)C1=NO[C@H]2[C@@H]1[C@H](C)C[C@@H]2C(=O)ONC(C)(C)C |
| InChI | InChI=1S/C17H30N2O3/c1-7-11(8-2)14-13-10(3)9-12(15(13)21-18-14)16(20)22-19-17(4,5)6/h10-13,15,19H,7-9H2,1-6H3/t10-,12+,13-,15-/m1/s1 |
| InChIKey | DQTPVOJHLDXRQC-CQROYNQRSA-N |
| XLogP | 3.30 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|