C11H17NO2 — CID 154717493
(1S,2R,4R,6R)-7-pentan-3-yl-3,9-dioxa-8-azatricyclo[4.3.0.02,4]non-7-ene (PubChem CID 154717493) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S,2R,4R,6R)-7-pentan-3-yl-3,9-dioxa-8-azatricyclo[4.3.0.02,4]non-7-ene.
| Compound Name | (1S,2R,4R,6R)-7-pentan-3-yl-3,9-dioxa-8-azatricyclo[4.3.0.02,4]non-7-ene |
|---|---|
| PubChem CID | 154717493 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S,2R,4R,6R)-7-pentan-3-yl-3,9-dioxa-8-azatricyclo[4.3.0.02,4]non-7-ene |
| SMILES | CCC(CC)C1=NO[C@@H]2[C@@H]3O[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C11H17NO2/c1-3-6(4-2)9-7-5-8-11(13-8)10(7)14-12-9/h6-8,10-11H,3-5H2,1-2H3/t7-,8-,10+,11-/m1/s1 |
| InChIKey | PIYPAVITAIFZLX-DEKFOEGESA-N |
| XLogP | 1.96 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|