C20H17NO3S2 — CID 118069522
(5Z)-3-[4-(hydroxymethyl)phenyl]-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118069522) has the molecular formula C20H17NO3S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is (5Z)-3-[4-(hydroxymethyl)phenyl]-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[4-(hydroxymethyl)phenyl]-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118069522 |
| Molecular Formula | C20H17NO3S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (5Z)-3-[4-(hydroxymethyl)phenyl]-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cccc(/C=C2\SC(=S)N(c3ccc(CO)cc3)C2=O)c1O |
| InChI | InChI=1S/C20H17NO3S2/c1-2-4-14-5-3-6-15(18(14)23)11-17-19(24)21(20(25)26-17)16-9-7-13(12-22)8-10-16/h2-3,5-11,22-23H,1,4,12H2/b17-11- |
| InChIKey | RLZUWERTJZCBBS-BOPFTXTBSA-N |
| XLogP | 4.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|