C16H15FN4O2 — CID 118071000
2-(cyclopropanecarbonylamino)-N-(6-fluoro-5-methyl-3-pyridinyl)pyridine-4-carboxamide (PubChem CID 118071000) has the molecular formula C16H15FN4O2 and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-N-(6-fluoro-5-methyl-3-pyridinyl)pyridine-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonylamino)-N-(6-fluoro-5-methyl-3-pyridinyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118071000 |
| Molecular Formula | C16H15FN4O2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-N-(6-fluoro-5-methyl-3-pyridinyl)pyridine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccnc(NC(=O)C3CC3)c2)cnc1F |
| InChI | InChI=1S/C16H15FN4O2/c1-9-6-12(8-19-14(9)17)20-16(23)11-4-5-18-13(7-11)21-15(22)10-2-3-10/h4-8,10H,2-3H2,1H3,(H,20,23)(H,18,21,22) |
| InChIKey | XXNHQMFVKYOPJT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|