C20H21FN4O3 — CID 138989575
2-(cyclopropanecarbonylamino)-N-[3-[(4-fluorobenzoyl)amino]propyl]pyridine-4-carboxamide (PubChem CID 138989575) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-N-[3-[(4-fluorobenzoyl)amino]propyl]pyridine-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonylamino)-N-[3-[(4-fluorobenzoyl)amino]propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 138989575 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-N-[3-[(4-fluorobenzoyl)amino]propyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1ccnc(NC(=O)C2CC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O3/c21-16-6-4-13(5-7-16)18(26)23-9-1-10-24-19(27)15-8-11-22-17(12-15)25-20(28)14-2-3-14/h4-8,11-12,14H,1-3,9-10H2,(H,23,26)(H,24,27)(H,22,25,28) |
| InChIKey | ZWQFFXOTICETNU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|