C18H17F3N4O3 — CID 138997636
2-(cyclopropanecarbonylamino)-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyridine-4-carboxamide (PubChem CID 138997636) has the molecular formula C18H17F3N4O3 and a molecular weight of 394.35 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonylamino)-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 138997636 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-N-[2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCOc1cccc(C(F)(F)F)n1)c1ccnc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C18H17F3N4O3/c19-18(20,21)13-2-1-3-15(24-13)28-9-8-23-16(26)12-6-7-22-14(10-12)25-17(27)11-4-5-11/h1-3,6-7,10-11H,4-5,8-9H2,(H,23,26)(H,22,25,27) |
| InChIKey | UUDRQUDXXFGXLQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|