C17H18N4O4 — CID 138989560
2-(cyclopropanecarbonylamino)-N-[2-(furan-2-carbonylamino)ethyl]pyridine-4-carboxamide (PubChem CID 138989560) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-N-[2-(furan-2-carbonylamino)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonylamino)-N-[2-(furan-2-carbonylamino)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 138989560 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-N-[2-(furan-2-carbonylamino)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccco1)c1ccnc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C17H18N4O4/c22-15(19-7-8-20-17(24)13-2-1-9-25-13)12-5-6-18-14(10-12)21-16(23)11-3-4-11/h1-2,5-6,9-11H,3-4,7-8H2,(H,19,22)(H,20,24)(H,18,21,23) |
| InChIKey | YCEFAXYHLVTFHH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|