C43H69N5O3 — CID 118072282
4-[(1S)-1-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-1-[3,5-bis(ethylaminomethyl)-4-hydroxyphenyl]ethyl]-2-(diethylaminomethyl)-6-ethylphenol (PubChem CID 118072282) has the molecular formula C43H69N5O3 and a molecular weight of 704.06 g/mol. Its IUPAC name is 4-[(1S)-1-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-1-[3,5-bis(ethylaminomethyl)-4-hydroxyphenyl]ethyl]-2-(diethylaminomethyl)-6-ethylphenol.
| Compound Name | 4-[(1S)-1-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-1-[3,5-bis(ethylaminomethyl)-4-hydroxyphenyl]ethyl]-2-(diethylaminomethyl)-6-ethylphenol |
|---|---|
| PubChem CID | 118072282 |
| Molecular Formula | C43H69N5O3 |
| Molecular Weight | 704.06 g/mol |
| Exact Mass | 703.54 |
| IUPAC Name | 4-[(1S)-1-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-1-[3,5-bis(ethylaminomethyl)-4-hydroxyphenyl]ethyl]-2-(diethylaminomethyl)-6-ethylphenol |
| SMILES | CCNCc1cc([C@](C)(c2cc(CC)c(O)c(CN(CC)CC)c2)c2cc(CN(CC)CC)c(O)c(CN(CC)CC)c2)cc(CNCC)c1O |
| InChI | InChI=1S/C43H69N5O3/c1-11-31-20-37(23-34(40(31)49)28-46(14-4)15-5)43(10,38-21-32(26-44-12-2)41(50)33(22-38)27-45-13-3)39-24-35(29-47(16-6)17-7)42(51)36(25-39)30-48(18-8)19-9/h20-25,44-45,49-51H,11-19,26-30H2,1-10H3/t43-/m0/s1 |
| InChIKey | ZAUWVPBKJCVWCA-QLKFWGTOSA-N |
| XLogP | 7.46 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.06 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|