C22H15ClFN5O — CID 118072376
2-[(6-chloro-2-pyridinyl)amino]-N-[5-(2-fluorophenyl)-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 118072376) has the molecular formula C22H15ClFN5O and a molecular weight of 419.85 g/mol. Its IUPAC name is 2-[(6-chloro-2-pyridinyl)amino]-N-[5-(2-fluorophenyl)-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-[(6-chloro-2-pyridinyl)amino]-N-[5-(2-fluorophenyl)-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118072376 |
| Molecular Formula | C22H15ClFN5O |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-[(6-chloro-2-pyridinyl)amino]-N-[5-(2-fluorophenyl)-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cncc(-c2ccccc2F)c1)c1ccnc(Nc2cccc(Cl)n2)c1 |
| InChI | InChI=1S/C22H15ClFN5O/c23-19-6-3-7-20(28-19)29-21-11-14(8-9-26-21)22(30)27-16-10-15(12-25-13-16)17-4-1-2-5-18(17)24/h1-13H,(H,27,30)(H,26,28,29) |
| InChIKey | SUAAWJFROCBAMY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|