C22H16FN5O — CID 118064170
2-[(6-fluoro-2-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyridine-4-carboxamide (PubChem CID 118064170) has the molecular formula C22H16FN5O and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[(6-fluoro-2-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyridine-4-carboxamide.
| Compound Name | 2-[(6-fluoro-2-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118064170 |
| Molecular Formula | C22H16FN5O |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[(6-fluoro-2-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cnccc1-c1ccccc1)c1ccnc(Nc2cccc(F)n2)c1 |
| InChI | InChI=1S/C22H16FN5O/c23-19-7-4-8-20(27-19)28-21-13-16(9-12-25-21)22(29)26-18-14-24-11-10-17(18)15-5-2-1-3-6-15/h1-14H,(H,26,29)(H,25,27,28) |
| InChIKey | CEDKYLJOMBVJPR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|