C21H15FN6O — CID 134556611
2-[(6-fluoro-3-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyrimidine-4-carboxamide (PubChem CID 134556611) has the molecular formula C21H15FN6O and a molecular weight of 386.39 g/mol. Its IUPAC name is 2-[(6-fluoro-3-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[(6-fluoro-3-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 134556611 |
| Molecular Formula | C21H15FN6O |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-[(6-fluoro-3-pyridinyl)amino]-N-(4-phenyl-3-pyridinyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cnccc1-c1ccccc1)c1ccnc(Nc2ccc(F)nc2)n1 |
| InChI | InChI=1S/C21H15FN6O/c22-19-7-6-15(12-25-19)26-21-24-11-9-17(28-21)20(29)27-18-13-23-10-8-16(18)14-4-2-1-3-5-14/h1-13H,(H,27,29)(H,24,26,28) |
| InChIKey | IZAQIVVCPRFMCI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|