C22H19ClN4O2 — CID 141452842
2-N-(3-chlorocyclobutyl)-4-N-(4-phenyl-3-pyridinyl)pyridine-2,4-dicarboxamide (PubChem CID 141452842) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 2-N-(3-chlorocyclobutyl)-4-N-(4-phenyl-3-pyridinyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-chlorocyclobutyl)-4-N-(4-phenyl-3-pyridinyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 141452842 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-N-(3-chlorocyclobutyl)-4-N-(4-phenyl-3-pyridinyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1cnccc1-c1ccccc1)c1ccnc(C(=O)NC2CC(Cl)C2)c1 |
| InChI | InChI=1S/C22H19ClN4O2/c23-16-11-17(12-16)26-22(29)19-10-15(6-9-25-19)21(28)27-20-13-24-8-7-18(20)14-4-2-1-3-5-14/h1-10,13,16-17H,11-12H2,(H,26,29)(H,27,28) |
| InChIKey | GPHDFRBFGUUUEC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|