About 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid
2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid (PubChem CID 118073190) has the molecular formula C25H30N2O3
and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid |
| PubChem CID | 118073190 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid |
| SMILES | CC(CC(=O)N1C2CC3CC1CC(C2)C3C(=O)O)c1c[nH]c2cccc(C3CC3)c12 |
| InChI | InChI=1S/C25H30N2O3/c1-13(20-12-26-21-4-2-3-19(24(20)21)14-5-6-14)7-22(28)27-17-8-15-9-18(27)11-16(10-17)23(15)25(29)30/h2-4,12-18,23,26H,5-11H2,1H3,(H,29,30) |
| InChIKey | XHGXIKBVSDQWIN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid?
The IUPAC name of 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid (CID 118073190) is 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid.
What is the SMILES notation for 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid?
The canonical SMILES for 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid is CC(CC(=O)N1C2CC3CC1CC(C2)C3C(=O)O)c1c[nH]c2cccc(C3CC3)c12.
What is the InChIKey of 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid?
The InChIKey is XHGXIKBVSDQWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O3/c1-13(20-12-26-21-4-2-3-19(24(20)21)14-5-6-14)7-22(28)27-17-8-15-9-18(27)11-16(10-17)23(15)25(29)30/h2-4,12-18,23,26H,5-11H2,1H3,(H,29,30).
What are the key properties of 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid?
2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid has a molecular weight of 406.53 g/mol, XLogP of 4.64, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-cyclopropyl-1H-indol-3-yl)butanoyl]-2-azatricyclo[3.3.1.13,7]decane-6-carboxylic acid is sourced from PubChem (CID 118073190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).