C16H15N — CID 11807349
1-(4-methylphenyl)-3,4-dihydroisoquinoline (PubChem CID 11807349) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3,4-dihydroisoquinoline.
| Compound Name | 1-(4-methylphenyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 11807349 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-(4-methylphenyl)-3,4-dihydroisoquinoline |
| SMILES | Cc1ccc(C2=NCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N/c1-12-6-8-14(9-7-12)16-15-5-3-2-4-13(15)10-11-17-16/h2-9H,10-11H2,1H3 |
| InChIKey | XQROEYGMOBUPJP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |