C13H12FNO2S — CID 11807575
methyl 5-(4-fluorophenyl)-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate (PubChem CID 11807575) has the molecular formula C13H12FNO2S and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 5-(4-fluorophenyl)-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate.
| Compound Name | methyl 5-(4-fluorophenyl)-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate |
|---|---|
| PubChem CID | 11807575 |
| Molecular Formula | C13H12FNO2S |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | methyl 5-(4-fluorophenyl)-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate |
| SMILES | COC(=O)C1N=C(c2ccc(F)cc2)SC12CC2 |
| InChI | InChI=1S/C13H12FNO2S/c1-17-12(16)10-13(6-7-13)18-11(15-10)8-2-4-9(14)5-3-8/h2-5,10H,6-7H2,1H3 |
| InChIKey | BCAWXJOQIYTULS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |