C13H12N4OS — CID 11807823
2-amino-1-(4-methylphenyl)-4-methylsulfanyl-6-oxopyrimidine-5-carbonitrile (PubChem CID 11807823) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-amino-1-(4-methylphenyl)-4-methylsulfanyl-6-oxopyrimidine-5-carbonitrile.
| Compound Name | 2-amino-1-(4-methylphenyl)-4-methylsulfanyl-6-oxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 11807823 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-amino-1-(4-methylphenyl)-4-methylsulfanyl-6-oxopyrimidine-5-carbonitrile |
| SMILES | CSc1nc(N)n(-c2ccc(C)cc2)c(=O)c1C#N |
| InChI | InChI=1S/C13H12N4OS/c1-8-3-5-9(6-4-8)17-12(18)10(7-14)11(19-2)16-13(17)15/h3-6H,1-2H3,(H2,15,16) |
| InChIKey | GNQOFQOKJFMBKP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |