C10H11N5O — CID 13111420
4,6-diamino-1-(4-methylphenyl)-1,3,5-triazin-2-one (PubChem CID 13111420) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 4,6-diamino-1-(4-methylphenyl)-1,3,5-triazin-2-one.
| Compound Name | 4,6-diamino-1-(4-methylphenyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 13111420 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4,6-diamino-1-(4-methylphenyl)-1,3,5-triazin-2-one |
| SMILES | Cc1ccc(-n2c(N)nc(N)nc2=O)cc1 |
| InChI | InChI=1S/C10H11N5O/c1-6-2-4-7(5-3-6)15-9(12)13-8(11)14-10(15)16/h2-5H,1H3,(H4,11,12,13,14,16) |
| InChIKey | LVTBHSVVLWXSGY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |