C14H13N3O — CID 84799605
2-amino-3-(4-methylphenyl)benzimidazol-4-ol (PubChem CID 84799605) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-amino-3-(4-methylphenyl)benzimidazol-4-ol.
| Compound Name | 2-amino-3-(4-methylphenyl)benzimidazol-4-ol |
|---|---|
| PubChem CID | 84799605 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-amino-3-(4-methylphenyl)benzimidazol-4-ol |
| SMILES | Cc1ccc(-n2c(N)nc3cccc(O)c32)cc1 |
| InChI | InChI=1S/C14H13N3O/c1-9-5-7-10(8-6-9)17-13-11(16-14(17)15)3-2-4-12(13)18/h2-8,18H,1H3,(H2,15,16) |
| InChIKey | IWOATGADWDQXLA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |