C16H11FO2 — CID 118078399
bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-fluorobenzoate (PubChem CID 118078399) has the molecular formula C16H11FO2 and a molecular weight of 254.26 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-fluorobenzoate.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 118078399 |
| Molecular Formula | C16H11FO2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-fluorobenzoate |
| SMILES | C#Cc1cccc(C(=O)OC)c1F.c1cc2cc-2c1 |
| InChI | InChI=1S/C10H7FO2.C6H4/c1-3-7-5-4-6-8(9(7)11)10(12)13-2;1-2-5-4-6(5)3-1/h1,4-6H,2H3;1-4H |
| InChIKey | QNQHWRKHZDCUCL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|