C29H25NO2 — CID 87312936
bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-[1-(naphthalen-2-ylamino)propyl]benzoate (PubChem CID 87312936) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-[1-(naphthalen-2-ylamino)propyl]benzoate.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-[1-(naphthalen-2-ylamino)propyl]benzoate |
|---|---|
| PubChem CID | 87312936 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;methyl 3-ethynyl-2-[1-(naphthalen-2-ylamino)propyl]benzoate |
| SMILES | C#Cc1cccc(C(=O)OC)c1C(CC)Nc1ccc2ccccc2c1.c1cc2cc-2c1 |
| InChI | InChI=1S/C23H21NO2.C6H4/c1-4-16-11-8-12-20(23(25)26-3)22(16)21(5-2)24-19-14-13-17-9-6-7-10-18(17)15-19;1-2-5-4-6(5)3-1/h1,6-15,21,24H,5H2,2-3H3;1-4H |
| InChIKey | DZVYSZINSUCXMQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|