C16H14Cl2N2O5 — CID 100642643
methyl 5-[[(1S)-1-(2,6-dichlorophenyl)-2-hydroxyethyl]amino]-2-nitrobenzoate (PubChem CID 100642643) has the molecular formula C16H14Cl2N2O5 and a molecular weight of 385.20 g/mol. Its IUPAC name is methyl 5-[[(1S)-1-(2,6-dichlorophenyl)-2-hydroxyethyl]amino]-2-nitrobenzoate.
| Compound Name | methyl 5-[[(1S)-1-(2,6-dichlorophenyl)-2-hydroxyethyl]amino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 100642643 |
| Molecular Formula | C16H14Cl2N2O5 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | methyl 5-[[(1S)-1-(2,6-dichlorophenyl)-2-hydroxyethyl]amino]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N[C@H](CO)c2c(Cl)cccc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14Cl2N2O5/c1-25-16(22)10-7-9(5-6-14(10)20(23)24)19-13(8-21)15-11(17)3-2-4-12(15)18/h2-7,13,19,21H,8H2,1H3/t13-/m1/s1 |
| InChIKey | ORZJSDXAMYQTGD-CYBMUJFWSA-N |
| XLogP | 3.83 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|