C15H21N3O5 — CID 133386455
methyl 5-[1-(4-methylmorpholin-2-yl)ethylamino]-2-nitrobenzoate (PubChem CID 133386455) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 5-[1-(4-methylmorpholin-2-yl)ethylamino]-2-nitrobenzoate.
| Compound Name | methyl 5-[1-(4-methylmorpholin-2-yl)ethylamino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 133386455 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | methyl 5-[1-(4-methylmorpholin-2-yl)ethylamino]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(NC(C)C2CN(C)CCO2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O5/c1-10(14-9-17(2)6-7-23-14)16-11-4-5-13(18(20)21)12(8-11)15(19)22-3/h4-5,8,10,14,16H,6-7,9H2,1-3H3 |
| InChIKey | YLXPDBSUDZWWKM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|