C16H19BrN2O3S — CID 118079189
N-[5-bromo-2-[[(2S)-1-hydroxypropan-2-yl]amino]phenyl]-4-methylbenzenesulfonamide (PubChem CID 118079189) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is N-[5-bromo-2-[[(2S)-1-hydroxypropan-2-yl]amino]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-bromo-2-[[(2S)-1-hydroxypropan-2-yl]amino]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 118079189 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | N-[5-bromo-2-[[(2S)-1-hydroxypropan-2-yl]amino]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Br)ccc2N[C@@H](C)CO)cc1 |
| InChI | InChI=1S/C16H19BrN2O3S/c1-11-3-6-14(7-4-11)23(21,22)19-16-9-13(17)5-8-15(16)18-12(2)10-20/h3-9,12,18-20H,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | MWQAUYOVDKBSIR-LBPRGKRZSA-N |
| XLogP | 3.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |