C15H16BrNO2S — CID 169372007
N-(5-bromo-2-ethylphenyl)-4-methylbenzenesulfonamide (PubChem CID 169372007) has the molecular formula C15H16BrNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is N-(5-bromo-2-ethylphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(5-bromo-2-ethylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169372007 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-(5-bromo-2-ethylphenyl)-4-methylbenzenesulfonamide |
| SMILES | CCc1ccc(Br)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H16BrNO2S/c1-3-12-6-7-13(16)10-15(12)17-20(18,19)14-8-4-11(2)5-9-14/h4-10,17H,3H2,1-2H3 |
| InChIKey | HNLCXGHKKAJUDL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |