C15H18O5 — CID 11808018
ethyl 5-(2-hydroxyethyl)-2-methyl-4,7-dioxo-1,3-dihydroindene-2-carboxylate (PubChem CID 11808018) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is ethyl 5-(2-hydroxyethyl)-2-methyl-4,7-dioxo-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 5-(2-hydroxyethyl)-2-methyl-4,7-dioxo-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 11808018 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | ethyl 5-(2-hydroxyethyl)-2-methyl-4,7-dioxo-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(C)CC2=C(C1)C(=O)C(CCO)=CC2=O |
| InChI | InChI=1S/C15H18O5/c1-3-20-14(19)15(2)7-10-11(8-15)13(18)9(4-5-16)6-12(10)17/h6,16H,3-5,7-8H2,1-2H3 |
| InChIKey | CUKOTLIXENKGTI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|